C14H19N3O4 — CID 81090456
5-[[[cyclopropyl(2-methoxyethyl)carbamoyl]amino]methyl]pyridine-2-carboxylic acid (PubChem CID 81090456) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 5-[[[cyclopropyl(2-methoxyethyl)carbamoyl]amino]methyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[[[cyclopropyl(2-methoxyethyl)carbamoyl]amino]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 81090456 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 5-[[[cyclopropyl(2-methoxyethyl)carbamoyl]amino]methyl]pyridine-2-carboxylic acid |
| SMILES | COCCN(C(=O)NCc1ccc(C(=O)O)nc1)C1CC1 |
| InChI | InChI=1S/C14H19N3O4/c1-21-7-6-17(11-3-4-11)14(20)16-9-10-2-5-12(13(18)19)15-8-10/h2,5,8,11H,3-4,6-7,9H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | RAAGXWINILPBML-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |