C17H12ClFOS — CID 81105629
5-[chloro-(6-fluoro-1-benzothiophen-2-yl)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 81105629) has the molecular formula C17H12ClFOS and a molecular weight of 318.80 g/mol. Its IUPAC name is 5-[chloro-(6-fluoro-1-benzothiophen-2-yl)methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-[chloro-(6-fluoro-1-benzothiophen-2-yl)methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 81105629 |
| Molecular Formula | C17H12ClFOS |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 5-[chloro-(6-fluoro-1-benzothiophen-2-yl)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | Fc1ccc2cc(C(Cl)c3ccc4c(c3)CCO4)sc2c1 |
| InChI | InChI=1S/C17H12ClFOS/c18-17(12-2-4-14-10(7-12)5-6-20-14)16-8-11-1-3-13(19)9-15(11)21-16/h1-4,7-9,17H,5-6H2 |
| InChIKey | QESGFMMAFPLIQX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|