C8H13FN2O — CID 81106816
3-fluoro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]propan-1-amine (PubChem CID 81106816) has the molecular formula C8H13FN2O and a molecular weight of 172.20 g/mol. Its IUPAC name is 3-fluoro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]propan-1-amine.
| Compound Name | 3-fluoro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 81106816 |
| Molecular Formula | C8H13FN2O |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 3-fluoro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]propan-1-amine |
| SMILES | Cc1cc(CNCCCF)no1 |
| InChI | InChI=1S/C8H13FN2O/c1-7-5-8(11-12-7)6-10-4-2-3-9/h5,10H,2-4,6H2,1H3 |
| InChIKey | UPMFMJCWTGRYER-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|