C18H23NO2 — CID 81112090
(2,2-dimethylpyrrolidin-1-yl)-[2-(4-hydroxybut-1-ynyl)-5-methylphenyl]methanone (PubChem CID 81112090) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (2,2-dimethylpyrrolidin-1-yl)-[2-(4-hydroxybut-1-ynyl)-5-methylphenyl]methanone.
| Compound Name | (2,2-dimethylpyrrolidin-1-yl)-[2-(4-hydroxybut-1-ynyl)-5-methylphenyl]methanone |
|---|---|
| PubChem CID | 81112090 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (2,2-dimethylpyrrolidin-1-yl)-[2-(4-hydroxybut-1-ynyl)-5-methylphenyl]methanone |
| SMILES | Cc1ccc(C#CCCO)c(C(=O)N2CCCC2(C)C)c1 |
| InChI | InChI=1S/C18H23NO2/c1-14-8-9-15(7-4-5-12-20)16(13-14)17(21)19-11-6-10-18(19,2)3/h8-9,13,20H,5-6,10-12H2,1-3H3 |
| InChIKey | RBKDCUYIADWQHZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|