C13H24N2O — CID 81116218
2-pyrrolidin-3-yl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81116218) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-pyrrolidin-3-yl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-pyrrolidin-3-yl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81116218 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 2-pyrrolidin-3-yl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | OC12CCCCC1CN(C1CCNC1)CC2 |
| InChI | InChI=1S/C13H24N2O/c16-13-5-2-1-3-11(13)10-15(8-6-13)12-4-7-14-9-12/h11-12,14,16H,1-10H2 |
| InChIKey | WCLKVJBJCMCBAJ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |