C14H17N3O2S — CID 81124708
(3S)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)piperidine-3-carboxamide (PubChem CID 81124708) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is (3S)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 81124708 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | (3S)-N-(3-oxo-4H-1,4-benzothiazin-6-yl)piperidine-3-carboxamide |
| SMILES | O=C1CSc2ccc(NC(=O)[C@H]3CCCNC3)cc2N1 |
| InChI | InChI=1S/C14H17N3O2S/c18-13-8-20-12-4-3-10(6-11(12)17-13)16-14(19)9-2-1-5-15-7-9/h3-4,6,9,15H,1-2,5,7-8H2,(H,16,19)(H,17,18)/t9-/m0/s1 |
| InChIKey | KAEVZVMTXFASOE-VIFPVBQESA-N |
| XLogP | 1.67 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |