C13H15N3O2S — CID 63006250
N-(3-oxo-4H-1,4-benzothiazin-6-yl)pyrrolidine-3-carboxamide (PubChem CID 63006250) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is N-(3-oxo-4H-1,4-benzothiazin-6-yl)pyrrolidine-3-carboxamide.
| Compound Name | N-(3-oxo-4H-1,4-benzothiazin-6-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 63006250 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-(3-oxo-4H-1,4-benzothiazin-6-yl)pyrrolidine-3-carboxamide |
| SMILES | O=C1CSc2ccc(NC(=O)C3CCNC3)cc2N1 |
| InChI | InChI=1S/C13H15N3O2S/c17-12-7-19-11-2-1-9(5-10(11)16-12)15-13(18)8-3-4-14-6-8/h1-2,5,8,14H,3-4,6-7H2,(H,15,18)(H,16,17) |
| InChIKey | CEYMRZDZRPLRBC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |