C14H17N3O2S — CID 66008736
3-amino-N-(3-oxo-4H-1,4-benzothiazin-6-yl)cyclopentane-1-carboxamide (PubChem CID 66008736) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 3-amino-N-(3-oxo-4H-1,4-benzothiazin-6-yl)cyclopentane-1-carboxamide.
| Compound Name | 3-amino-N-(3-oxo-4H-1,4-benzothiazin-6-yl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 66008736 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 3-amino-N-(3-oxo-4H-1,4-benzothiazin-6-yl)cyclopentane-1-carboxamide |
| SMILES | NC1CCC(C(=O)Nc2ccc3c(c2)NC(=O)CS3)C1 |
| InChI | InChI=1S/C14H17N3O2S/c15-9-2-1-8(5-9)14(19)16-10-3-4-12-11(6-10)17-13(18)7-20-12/h3-4,6,8-9H,1-2,5,7,15H2,(H,16,19)(H,17,18) |
| InChIKey | AOPLDCWCPYNQKH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |