C15H8BrClS3 — CID 81128259
7-bromo-3-[chloro(thieno[3,2-b]thiophen-5-yl)methyl]-1-benzothiophene (PubChem CID 81128259) has the molecular formula C15H8BrClS3 and a molecular weight of 399.79 g/mol. Its IUPAC name is 7-bromo-3-[chloro(thieno[3,2-b]thiophen-5-yl)methyl]-1-benzothiophene.
| Compound Name | 7-bromo-3-[chloro(thieno[3,2-b]thiophen-5-yl)methyl]-1-benzothiophene |
|---|---|
| PubChem CID | 81128259 |
| Molecular Formula | C15H8BrClS3 |
| Molecular Weight | 399.79 g/mol |
| Exact Mass | 397.87 |
| IUPAC Name | 7-bromo-3-[chloro(thieno[3,2-b]thiophen-5-yl)methyl]-1-benzothiophene |
| SMILES | ClC(c1cc2sccc2s1)c1csc2c(Br)cccc12 |
| InChI | InChI=1S/C15H8BrClS3/c16-10-3-1-2-8-9(7-19-15(8)10)14(17)13-6-12-11(20-13)4-5-18-12/h1-7,14H |
| InChIKey | KYTNQDDGWBMBMA-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.79 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|