C13H11ClF2OS — CID 81129991
2-[1-chloro-2-(3,4-difluorophenyl)ethyl]-3-methoxythiophene (PubChem CID 81129991) has the molecular formula C13H11ClF2OS and a molecular weight of 288.75 g/mol. Its IUPAC name is 2-[1-chloro-2-(3,4-difluorophenyl)ethyl]-3-methoxythiophene.
| Compound Name | 2-[1-chloro-2-(3,4-difluorophenyl)ethyl]-3-methoxythiophene |
|---|---|
| PubChem CID | 81129991 |
| Molecular Formula | C13H11ClF2OS |
| Molecular Weight | 288.75 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 2-[1-chloro-2-(3,4-difluorophenyl)ethyl]-3-methoxythiophene |
| SMILES | COc1ccsc1C(Cl)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H11ClF2OS/c1-17-12-4-5-18-13(12)9(14)6-8-2-3-10(15)11(16)7-8/h2-5,7,9H,6H2,1H3 |
| InChIKey | RMSQJTZCUGFTTD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.75 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|