C16H19ClO2S — CID 79974959
2-[1-chloro-2-(3,4-dimethoxyphenyl)ethyl]-3-ethylthiophene (PubChem CID 79974959) has the molecular formula C16H19ClO2S and a molecular weight of 310.85 g/mol. Its IUPAC name is 2-[1-chloro-2-(3,4-dimethoxyphenyl)ethyl]-3-ethylthiophene.
| Compound Name | 2-[1-chloro-2-(3,4-dimethoxyphenyl)ethyl]-3-ethylthiophene |
|---|---|
| PubChem CID | 79974959 |
| Molecular Formula | C16H19ClO2S |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-[1-chloro-2-(3,4-dimethoxyphenyl)ethyl]-3-ethylthiophene |
| SMILES | CCc1ccsc1C(Cl)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H19ClO2S/c1-4-12-7-8-20-16(12)13(17)9-11-5-6-14(18-2)15(10-11)19-3/h5-8,10,13H,4,9H2,1-3H3 |
| InChIKey | YMWPIWWHJINBRS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|