C14H16ClNO2S — CID 114031406
4-[1-chloro-2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-1,3-thiazole (PubChem CID 114031406) has the molecular formula C14H16ClNO2S and a molecular weight of 297.81 g/mol. Its IUPAC name is 4-[1-chloro-2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[1-chloro-2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 114031406 |
| Molecular Formula | C14H16ClNO2S |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 4-[1-chloro-2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-1,3-thiazole |
| SMILES | COc1ccc(CC(Cl)c2csc(C)n2)cc1OC |
| InChI | InChI=1S/C14H16ClNO2S/c1-9-16-12(8-19-9)11(15)6-10-4-5-13(17-2)14(7-10)18-3/h4-5,7-8,11H,6H2,1-3H3 |
| InChIKey | FUGJQVIROVSASK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|