C17H16O3S — CID 81131841
1-benzothiophen-7-yl-(3,4-dimethoxyphenyl)methanol (PubChem CID 81131841) has the molecular formula C17H16O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-benzothiophen-7-yl-(3,4-dimethoxyphenyl)methanol.
| Compound Name | 1-benzothiophen-7-yl-(3,4-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 81131841 |
| Molecular Formula | C17H16O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-benzothiophen-7-yl-(3,4-dimethoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)c2cccc3ccsc23)cc1OC |
| InChI | InChI=1S/C17H16O3S/c1-19-14-7-6-12(10-15(14)20-2)16(18)13-5-3-4-11-8-9-21-17(11)13/h3-10,16,18H,1-2H3 |
| InChIKey | FJBCZSZUIOVGOL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |