C18H22N2O — CID 81139220
2,2-dimethyl-N-(1-pyridin-3-ylethyl)-3,4-dihydrochromen-4-amine (PubChem CID 81139220) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 2,2-dimethyl-N-(1-pyridin-3-ylethyl)-3,4-dihydrochromen-4-amine.
| Compound Name | 2,2-dimethyl-N-(1-pyridin-3-ylethyl)-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 81139220 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2,2-dimethyl-N-(1-pyridin-3-ylethyl)-3,4-dihydrochromen-4-amine |
| SMILES | CC(NC1CC(C)(C)Oc2ccccc21)c1cccnc1 |
| InChI | InChI=1S/C18H22N2O/c1-13(14-7-6-10-19-12-14)20-16-11-18(2,3)21-17-9-5-4-8-15(16)17/h4-10,12-13,16,20H,11H2,1-3H3 |
| InChIKey | MZDRYTSYHCXXKW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |