C13H20N2O — CID 103948496
2,2-dimethyl-3-[[(1S)-1-pyridin-3-ylethyl]amino]cyclobutan-1-ol (PubChem CID 103948496) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 2,2-dimethyl-3-[[(1S)-1-pyridin-3-ylethyl]amino]cyclobutan-1-ol.
| Compound Name | 2,2-dimethyl-3-[[(1S)-1-pyridin-3-ylethyl]amino]cyclobutan-1-ol |
|---|---|
| PubChem CID | 103948496 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2,2-dimethyl-3-[[(1S)-1-pyridin-3-ylethyl]amino]cyclobutan-1-ol |
| SMILES | C[C@H](NC1CC(O)C1(C)C)c1cccnc1 |
| InChI | InChI=1S/C13H20N2O/c1-9(10-5-4-6-14-8-10)15-11-7-12(16)13(11,2)3/h4-6,8-9,11-12,15-16H,7H2,1-3H3/t9-,11?,12?/m0/s1 |
| InChIKey | RPXCAQPNEHUDEB-GCVQQVDUSA-N |
| XLogP | 1.89 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |