C15H17NOS — CID 81142463
2,2-dimethyl-N-thiophen-3-yl-3,4-dihydrochromen-4-amine (PubChem CID 81142463) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is 2,2-dimethyl-N-thiophen-3-yl-3,4-dihydrochromen-4-amine.
| Compound Name | 2,2-dimethyl-N-thiophen-3-yl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 81142463 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2,2-dimethyl-N-thiophen-3-yl-3,4-dihydrochromen-4-amine |
| SMILES | CC1(C)CC(Nc2ccsc2)c2ccccc2O1 |
| InChI | InChI=1S/C15H17NOS/c1-15(2)9-13(16-11-7-8-18-10-11)12-5-3-4-6-14(12)17-15/h3-8,10,13,16H,9H2,1-2H3 |
| InChIKey | LLZIVDCVUXNNKP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |