C15H12F2N2S — CID 81143289
2-(2,5-difluorophenyl)-1-thieno[3,2-b]pyridin-6-ylethanamine (PubChem CID 81143289) has the molecular formula C15H12F2N2S and a molecular weight of 290.34 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-1-thieno[3,2-b]pyridin-6-ylethanamine.
| Compound Name | 2-(2,5-difluorophenyl)-1-thieno[3,2-b]pyridin-6-ylethanamine |
|---|---|
| PubChem CID | 81143289 |
| Molecular Formula | C15H12F2N2S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-(2,5-difluorophenyl)-1-thieno[3,2-b]pyridin-6-ylethanamine |
| SMILES | NC(Cc1cc(F)ccc1F)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C15H12F2N2S/c16-11-1-2-12(17)9(5-11)6-13(18)10-7-15-14(19-8-10)3-4-20-15/h1-5,7-8,13H,6,18H2 |
| InChIKey | XTUSDPHNMQHVPS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |