C14H14N2S2 — CID 81144341
1-thieno[3,2-b]pyridin-6-yl-3-thiophen-2-ylpropan-1-amine (PubChem CID 81144341) has the molecular formula C14H14N2S2 and a molecular weight of 274.41 g/mol. Its IUPAC name is 1-thieno[3,2-b]pyridin-6-yl-3-thiophen-2-ylpropan-1-amine.
| Compound Name | 1-thieno[3,2-b]pyridin-6-yl-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 81144341 |
| Molecular Formula | C14H14N2S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 1-thieno[3,2-b]pyridin-6-yl-3-thiophen-2-ylpropan-1-amine |
| SMILES | NC(CCc1cccs1)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C14H14N2S2/c15-12(4-3-11-2-1-6-17-11)10-8-14-13(16-9-10)5-7-18-14/h1-2,5-9,12H,3-4,15H2 |
| InChIKey | QBYRWLNSKKBBTE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |