C16H22ClNO — CID 81145715
3-chloro-4-[(4,4-dimethylcyclohexyl)-methylamino]benzaldehyde (PubChem CID 81145715) has the molecular formula C16H22ClNO and a molecular weight of 279.81 g/mol. Its IUPAC name is 3-chloro-4-[(4,4-dimethylcyclohexyl)-methylamino]benzaldehyde.
| Compound Name | 3-chloro-4-[(4,4-dimethylcyclohexyl)-methylamino]benzaldehyde |
|---|---|
| PubChem CID | 81145715 |
| Molecular Formula | C16H22ClNO |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 3-chloro-4-[(4,4-dimethylcyclohexyl)-methylamino]benzaldehyde |
| SMILES | CN(c1ccc(C=O)cc1Cl)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H22ClNO/c1-16(2)8-6-13(7-9-16)18(3)15-5-4-12(11-19)10-14(15)17/h4-5,10-11,13H,6-9H2,1-3H3 |
| InChIKey | NEGYBKCYFVSEAF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|