C13H15NOS — CID 81146469
1-(1-benzothiophen-7-yl)-2-(cyclopropylamino)ethanol (PubChem CID 81146469) has the molecular formula C13H15NOS and a molecular weight of 233.34 g/mol. Its IUPAC name is 1-(1-benzothiophen-7-yl)-2-(cyclopropylamino)ethanol.
| Compound Name | 1-(1-benzothiophen-7-yl)-2-(cyclopropylamino)ethanol |
|---|---|
| PubChem CID | 81146469 |
| Molecular Formula | C13H15NOS |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 1-(1-benzothiophen-7-yl)-2-(cyclopropylamino)ethanol |
| SMILES | OC(CNC1CC1)c1cccc2ccsc12 |
| InChI | InChI=1S/C13H15NOS/c15-12(8-14-10-4-5-10)11-3-1-2-9-6-7-16-13(9)11/h1-3,6-7,10,12,14-15H,4-5,8H2 |
| InChIKey | UKNCCVPGNCAGRE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |