C18H24OS — CID 81154320
1-benzothiophen-7-yl-(4-propylcyclohexyl)methanol (PubChem CID 81154320) has the molecular formula C18H24OS and a molecular weight of 288.46 g/mol. Its IUPAC name is 1-benzothiophen-7-yl-(4-propylcyclohexyl)methanol.
| Compound Name | 1-benzothiophen-7-yl-(4-propylcyclohexyl)methanol |
|---|---|
| PubChem CID | 81154320 |
| Molecular Formula | C18H24OS |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1-benzothiophen-7-yl-(4-propylcyclohexyl)methanol |
| SMILES | CCCC1CCC(C(O)c2cccc3ccsc23)CC1 |
| InChI | InChI=1S/C18H24OS/c1-2-4-13-7-9-14(10-8-13)17(19)16-6-3-5-15-11-12-20-18(15)16/h3,5-6,11-14,17,19H,2,4,7-10H2,1H3 |
| InChIKey | XIXZKNQAZFQVCV-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |