C15H19NS — CID 81153500
1-benzothiophen-7-yl-(3-methylcyclopentyl)methanamine (PubChem CID 81153500) has the molecular formula C15H19NS and a molecular weight of 245.39 g/mol. Its IUPAC name is 1-benzothiophen-7-yl-(3-methylcyclopentyl)methanamine.
| Compound Name | 1-benzothiophen-7-yl-(3-methylcyclopentyl)methanamine |
|---|---|
| PubChem CID | 81153500 |
| Molecular Formula | C15H19NS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1-benzothiophen-7-yl-(3-methylcyclopentyl)methanamine |
| SMILES | CC1CCC(C(N)c2cccc3ccsc23)C1 |
| InChI | InChI=1S/C15H19NS/c1-10-5-6-12(9-10)14(16)13-4-2-3-11-7-8-17-15(11)13/h2-4,7-8,10,12,14H,5-6,9,16H2,1H3 |
| InChIKey | BWZKSIMAEGBAPS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |