C13H21NS — CID 81155881
2-cyclopentyl-1-(3,5-dimethylthiophen-2-yl)ethanamine (PubChem CID 81155881) has the molecular formula C13H21NS and a molecular weight of 223.38 g/mol. Its IUPAC name is 2-cyclopentyl-1-(3,5-dimethylthiophen-2-yl)ethanamine.
| Compound Name | 2-cyclopentyl-1-(3,5-dimethylthiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 81155881 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 2-cyclopentyl-1-(3,5-dimethylthiophen-2-yl)ethanamine |
| SMILES | Cc1cc(C)c(C(N)CC2CCCC2)s1 |
| InChI | InChI=1S/C13H21NS/c1-9-7-10(2)15-13(9)12(14)8-11-5-3-4-6-11/h7,11-12H,3-6,8,14H2,1-2H3 |
| InChIKey | SWEMGKYKGJCMCV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |