C14H21BrS — CID 81157820
2-[bromo(cycloheptyl)methyl]-3,5-dimethylthiophene (PubChem CID 81157820) has the molecular formula C14H21BrS and a molecular weight of 301.29 g/mol. Its IUPAC name is 2-[bromo(cycloheptyl)methyl]-3,5-dimethylthiophene.
| Compound Name | 2-[bromo(cycloheptyl)methyl]-3,5-dimethylthiophene |
|---|---|
| PubChem CID | 81157820 |
| Molecular Formula | C14H21BrS |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-[bromo(cycloheptyl)methyl]-3,5-dimethylthiophene |
| SMILES | Cc1cc(C)c(C(Br)C2CCCCCC2)s1 |
| InChI | InChI=1S/C14H21BrS/c1-10-9-11(2)16-14(10)13(15)12-7-5-3-4-6-8-12/h9,12-13H,3-8H2,1-2H3 |
| InChIKey | FLGBMEGUGSJKNP-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|