C11H15BrS — CID 81158372
2-[bromo(cyclobutyl)methyl]-3,5-dimethylthiophene (PubChem CID 81158372) has the molecular formula C11H15BrS and a molecular weight of 259.21 g/mol. Its IUPAC name is 2-[bromo(cyclobutyl)methyl]-3,5-dimethylthiophene.
| Compound Name | 2-[bromo(cyclobutyl)methyl]-3,5-dimethylthiophene |
|---|---|
| PubChem CID | 81158372 |
| Molecular Formula | C11H15BrS |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 2-[bromo(cyclobutyl)methyl]-3,5-dimethylthiophene |
| SMILES | Cc1cc(C)c(C(Br)C2CCC2)s1 |
| InChI | InChI=1S/C11H15BrS/c1-7-6-8(2)13-11(7)10(12)9-4-3-5-9/h6,9-10H,3-5H2,1-2H3 |
| InChIKey | XVXDFDIOJJCTME-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|