C14H23N3O4 — CID 81157459
1-[[2-(cyclohexylcarbamoylamino)-2-oxoethyl]amino]cyclobutane-1-carboxylic acid (PubChem CID 81157459) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is 1-[[2-(cyclohexylcarbamoylamino)-2-oxoethyl]amino]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[[2-(cyclohexylcarbamoylamino)-2-oxoethyl]amino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 81157459 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-[[2-(cyclohexylcarbamoylamino)-2-oxoethyl]amino]cyclobutane-1-carboxylic acid |
| SMILES | O=C(CNC1(C(=O)O)CCC1)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H23N3O4/c18-11(9-15-14(12(19)20)7-4-8-14)17-13(21)16-10-5-2-1-3-6-10/h10,15H,1-9H2,(H,19,20)(H2,16,17,18,21) |
| InChIKey | SPMVUMIXZZWKPC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |