C13H16FNO3 — CID 81167804
1-[2-(2-fluorophenoxy)ethylamino]cyclobutane-1-carboxylic acid (PubChem CID 81167804) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is 1-[2-(2-fluorophenoxy)ethylamino]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[2-(2-fluorophenoxy)ethylamino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 81167804 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 1-[2-(2-fluorophenoxy)ethylamino]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(NCCOc2ccccc2F)CCC1 |
| InChI | InChI=1S/C13H16FNO3/c14-10-4-1-2-5-11(10)18-9-8-15-13(12(16)17)6-3-7-13/h1-2,4-5,15H,3,6-9H2,(H,16,17) |
| InChIKey | DPHQUEPCYMQWHQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|