C11H13N3O3S — CID 81169954
1-(2-aminophenyl)-N-(1,2-oxazol-3-ylmethyl)methanesulfonamide (PubChem CID 81169954) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 1-(2-aminophenyl)-N-(1,2-oxazol-3-ylmethyl)methanesulfonamide.
| Compound Name | 1-(2-aminophenyl)-N-(1,2-oxazol-3-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 81169954 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 1-(2-aminophenyl)-N-(1,2-oxazol-3-ylmethyl)methanesulfonamide |
| SMILES | Nc1ccccc1CS(=O)(=O)NCc1ccon1 |
| InChI | InChI=1S/C11H13N3O3S/c12-11-4-2-1-3-9(11)8-18(15,16)13-7-10-5-6-17-14-10/h1-6,13H,7-8,12H2 |
| InChIKey | WCKQRETYPGFZPX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|