C12H15N3O2 — CID 81170745
2-ethoxy-4-N-(1,2-oxazol-3-ylmethyl)benzene-1,4-diamine (PubChem CID 81170745) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-ethoxy-4-N-(1,2-oxazol-3-ylmethyl)benzene-1,4-diamine.
| Compound Name | 2-ethoxy-4-N-(1,2-oxazol-3-ylmethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 81170745 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-ethoxy-4-N-(1,2-oxazol-3-ylmethyl)benzene-1,4-diamine |
| SMILES | CCOc1cc(NCc2ccon2)ccc1N |
| InChI | InChI=1S/C12H15N3O2/c1-2-16-12-7-9(3-4-11(12)13)14-8-10-5-6-17-15-10/h3-7,14H,2,8,13H2,1H3 |
| InChIKey | UZPISTAPUZUDMG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|