C12H16N4O2 — CID 81170070
2-N-(1,2-oxazol-3-ylmethyl)-6-propoxypyridine-2,5-diamine (PubChem CID 81170070) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-N-(1,2-oxazol-3-ylmethyl)-6-propoxypyridine-2,5-diamine.
| Compound Name | 2-N-(1,2-oxazol-3-ylmethyl)-6-propoxypyridine-2,5-diamine |
|---|---|
| PubChem CID | 81170070 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-N-(1,2-oxazol-3-ylmethyl)-6-propoxypyridine-2,5-diamine |
| SMILES | CCCOc1nc(NCc2ccon2)ccc1N |
| InChI | InChI=1S/C12H16N4O2/c1-2-6-17-12-10(13)3-4-11(15-12)14-8-9-5-7-18-16-9/h3-5,7H,2,6,8,13H2,1H3,(H,14,15) |
| InChIKey | ZPTDPHMWTONHAQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |