C13H17N3O3 — CID 81174234
3-methyl-2-(1,2-oxazol-3-ylmethyl)-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione (PubChem CID 81174234) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 3-methyl-2-(1,2-oxazol-3-ylmethyl)-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione.
| Compound Name | 3-methyl-2-(1,2-oxazol-3-ylmethyl)-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 81174234 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 3-methyl-2-(1,2-oxazol-3-ylmethyl)-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
| SMILES | CC1C(=O)N2CCCCC2C(=O)N1Cc1ccon1 |
| InChI | InChI=1S/C13H17N3O3/c1-9-12(17)15-6-3-2-4-11(15)13(18)16(9)8-10-5-7-19-14-10/h5,7,9,11H,2-4,6,8H2,1H3 |
| InChIKey | QFSWCCALQRAETB-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |