C9H20N2O3S2 — CID 81175130
2-[(1-methylsulfonylpiperidin-3-yl)methylsulfinyl]ethanamine (PubChem CID 81175130) has the molecular formula C9H20N2O3S2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-[(1-methylsulfonylpiperidin-3-yl)methylsulfinyl]ethanamine.
| Compound Name | 2-[(1-methylsulfonylpiperidin-3-yl)methylsulfinyl]ethanamine |
|---|---|
| PubChem CID | 81175130 |
| Molecular Formula | C9H20N2O3S2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-[(1-methylsulfonylpiperidin-3-yl)methylsulfinyl]ethanamine |
| SMILES | CS(=O)(=O)N1CCCC(CS(=O)CCN)C1 |
| InChI | InChI=1S/C9H20N2O3S2/c1-16(13,14)11-5-2-3-9(7-11)8-15(12)6-4-10/h9H,2-8,10H2,1H3 |
| InChIKey | CGLVUJINLCUJFS-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |