C13H25N3OS — CID 81189112
2-methyl-1-[(1-pentan-3-ylpyrazol-3-yl)methylsulfinyl]propan-2-amine (PubChem CID 81189112) has the molecular formula C13H25N3OS and a molecular weight of 271.43 g/mol. Its IUPAC name is 2-methyl-1-[(1-pentan-3-ylpyrazol-3-yl)methylsulfinyl]propan-2-amine.
| Compound Name | 2-methyl-1-[(1-pentan-3-ylpyrazol-3-yl)methylsulfinyl]propan-2-amine |
|---|---|
| PubChem CID | 81189112 |
| Molecular Formula | C13H25N3OS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2-methyl-1-[(1-pentan-3-ylpyrazol-3-yl)methylsulfinyl]propan-2-amine |
| SMILES | CCC(CC)n1ccc(CS(=O)CC(C)(C)N)n1 |
| InChI | InChI=1S/C13H25N3OS/c1-5-12(6-2)16-8-7-11(15-16)9-18(17)10-13(3,4)14/h7-8,12H,5-6,9-10,14H2,1-4H3 |
| InChIKey | ZZIBTUVUDPVSHI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |