C11H24N2O3S — CID 81194284
2-(2-aminobutylsulfonyl)-N-tert-butylpropanamide (PubChem CID 81194284) has the molecular formula C11H24N2O3S and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-(2-aminobutylsulfonyl)-N-tert-butylpropanamide.
| Compound Name | 2-(2-aminobutylsulfonyl)-N-tert-butylpropanamide |
|---|---|
| PubChem CID | 81194284 |
| Molecular Formula | C11H24N2O3S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-(2-aminobutylsulfonyl)-N-tert-butylpropanamide |
| SMILES | CCC(N)CS(=O)(=O)C(C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H24N2O3S/c1-6-9(12)7-17(15,16)8(2)10(14)13-11(3,4)5/h8-9H,6-7,12H2,1-5H3,(H,13,14) |
| InChIKey | CXHMPMYUCBWEMW-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |