C12H26N2O3S — CID 81202396
2-(3-amino-2-methylpropyl)sulfonyl-N-(2-methylbutan-2-yl)propanamide (PubChem CID 81202396) has the molecular formula C12H26N2O3S and a molecular weight of 278.42 g/mol. Its IUPAC name is 2-(3-amino-2-methylpropyl)sulfonyl-N-(2-methylbutan-2-yl)propanamide.
| Compound Name | 2-(3-amino-2-methylpropyl)sulfonyl-N-(2-methylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 81202396 |
| Molecular Formula | C12H26N2O3S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-(3-amino-2-methylpropyl)sulfonyl-N-(2-methylbutan-2-yl)propanamide |
| SMILES | CCC(C)(C)NC(=O)C(C)S(=O)(=O)CC(C)CN |
| InChI | InChI=1S/C12H26N2O3S/c1-6-12(4,5)14-11(15)10(3)18(16,17)8-9(2)7-13/h9-10H,6-8,13H2,1-5H3,(H,14,15) |
| InChIKey | OFTDAGDXDCJEFP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |