About 2-quinolin-7-yl-1,3-dihydroinden-2-amine
2-quinolin-7-yl-1,3-dihydroinden-2-amine (PubChem CID 81196665) has the molecular formula C18H16N2
and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-quinolin-7-yl-1,3-dihydroinden-2-amine.
Molecular Properties
| Compound Name | 2-quinolin-7-yl-1,3-dihydroinden-2-amine |
| PubChem CID | 81196665 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-quinolin-7-yl-1,3-dihydroinden-2-amine |
| SMILES | NC1(c2ccc3cccnc3c2)Cc2ccccc2C1 |
| InChI | InChI=1S/C18H16N2/c19-18(11-14-4-1-2-5-15(14)12-18)16-8-7-13-6-3-9-20-17(13)10-16/h1-10H,11-12,19H2 |
| InChIKey | BSLIDFOPAGBNRP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-quinolin-7-yl-1,3-dihydroinden-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-quinolin-7-yl-1,3-dihydroinden-2-amine?
The IUPAC name of 2-quinolin-7-yl-1,3-dihydroinden-2-amine (CID 81196665) is 2-quinolin-7-yl-1,3-dihydroinden-2-amine.
What is the SMILES notation for 2-quinolin-7-yl-1,3-dihydroinden-2-amine?
The canonical SMILES for 2-quinolin-7-yl-1,3-dihydroinden-2-amine is NC1(c2ccc3cccnc3c2)Cc2ccccc2C1.
What is the InChIKey of 2-quinolin-7-yl-1,3-dihydroinden-2-amine?
The InChIKey is BSLIDFOPAGBNRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2/c19-18(11-14-4-1-2-5-15(14)12-18)16-8-7-13-6-3-9-20-17(13)10-16/h1-10H,11-12,19H2.
What are the key properties of 2-quinolin-7-yl-1,3-dihydroinden-2-amine?
2-quinolin-7-yl-1,3-dihydroinden-2-amine has a molecular weight of 260.34 g/mol, XLogP of 3.19, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-quinolin-7-yl-1,3-dihydroinden-2-amine is sourced from PubChem (CID 81196665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).