C13H18BrNO4S2 — CID 81201605
4-bromo-2-(3-methylsulfonylcyclohexyl)sulfonylaniline (PubChem CID 81201605) has the molecular formula C13H18BrNO4S2 and a molecular weight of 396.33 g/mol. Its IUPAC name is 4-bromo-2-(3-methylsulfonylcyclohexyl)sulfonylaniline.
| Compound Name | 4-bromo-2-(3-methylsulfonylcyclohexyl)sulfonylaniline |
|---|---|
| PubChem CID | 81201605 |
| Molecular Formula | C13H18BrNO4S2 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | 4-bromo-2-(3-methylsulfonylcyclohexyl)sulfonylaniline |
| SMILES | CS(=O)(=O)C1CCCC(S(=O)(=O)c2cc(Br)ccc2N)C1 |
| InChI | InChI=1S/C13H18BrNO4S2/c1-20(16,17)10-3-2-4-11(8-10)21(18,19)13-7-9(14)5-6-12(13)15/h5-7,10-11H,2-4,8,15H2,1H3 |
| InChIKey | MWBMPELOXHYDFH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|