C13H24N2S — CID 81206409
(E)-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)but-2-ene-1-thiol (PubChem CID 81206409) has the molecular formula C13H24N2S and a molecular weight of 240.42 g/mol. Its IUPAC name is (E)-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)but-2-ene-1-thiol.
| Compound Name | (E)-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)but-2-ene-1-thiol |
|---|---|
| PubChem CID | 81206409 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (E)-4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)but-2-ene-1-thiol |
| SMILES | CN1CCCC2CN(C/C=C/CS)CCC21 |
| InChI | InChI=1S/C13H24N2S/c1-14-7-4-5-12-11-15(8-2-3-10-16)9-6-13(12)14/h2-3,12-13,16H,4-11H2,1H3/b3-2+ |
| InChIKey | ZRLJCPQYKNDXPL-NSCUHMNNSA-N |
| XLogP | 1.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|