C12H19NO3 — CID 81208351
cyclopent-3-en-1-yl-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]methanone (PubChem CID 81208351) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is cyclopent-3-en-1-yl-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]methanone.
| Compound Name | cyclopent-3-en-1-yl-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 81208351 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | cyclopent-3-en-1-yl-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]methanone |
| SMILES | CC1COC(CO)CN1C(=O)C1CC=CC1 |
| InChI | InChI=1S/C12H19NO3/c1-9-8-16-11(7-14)6-13(9)12(15)10-4-2-3-5-10/h2-3,9-11,14H,4-8H2,1H3 |
| InChIKey | AZOPWGPIZPFTJS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|