C13H16ClF2NO — CID 81210281
2-(chloromethyl)-4-[(2,4-difluorophenyl)methyl]-5-methylmorpholine (PubChem CID 81210281) has the molecular formula C13H16ClF2NO and a molecular weight of 275.73 g/mol. Its IUPAC name is 2-(chloromethyl)-4-[(2,4-difluorophenyl)methyl]-5-methylmorpholine.
| Compound Name | 2-(chloromethyl)-4-[(2,4-difluorophenyl)methyl]-5-methylmorpholine |
|---|---|
| PubChem CID | 81210281 |
| Molecular Formula | C13H16ClF2NO |
| Molecular Weight | 275.73 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-(chloromethyl)-4-[(2,4-difluorophenyl)methyl]-5-methylmorpholine |
| SMILES | CC1COC(CCl)CN1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C13H16ClF2NO/c1-9-8-18-12(5-14)7-17(9)6-10-2-3-11(15)4-13(10)16/h2-4,9,12H,5-8H2,1H3 |
| InChIKey | BUFLXQXLAXSSDC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.73 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|