C7H14F2N2O3S — CID 81216979
[4-(difluoromethylsulfonyl)-5-methylmorpholin-2-yl]methanamine (PubChem CID 81216979) has the molecular formula C7H14F2N2O3S and a molecular weight of 244.26 g/mol. Its IUPAC name is [4-(difluoromethylsulfonyl)-5-methylmorpholin-2-yl]methanamine.
| Compound Name | [4-(difluoromethylsulfonyl)-5-methylmorpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 81216979 |
| Molecular Formula | C7H14F2N2O3S |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | [4-(difluoromethylsulfonyl)-5-methylmorpholin-2-yl]methanamine |
| SMILES | CC1COC(CN)CN1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C7H14F2N2O3S/c1-5-4-14-6(2-10)3-11(5)15(12,13)7(8)9/h5-7H,2-4,10H2,1H3 |
| InChIKey | OVEDJFAZRZSRIZ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |