C8H18N2O5S2 — CID 82842298
[5-methyl-4-(methylsulfonylmethylsulfonyl)morpholin-2-yl]methanamine (PubChem CID 82842298) has the molecular formula C8H18N2O5S2 and a molecular weight of 286.38 g/mol. Its IUPAC name is [5-methyl-4-(methylsulfonylmethylsulfonyl)morpholin-2-yl]methanamine.
| Compound Name | [5-methyl-4-(methylsulfonylmethylsulfonyl)morpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 82842298 |
| Molecular Formula | C8H18N2O5S2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | [5-methyl-4-(methylsulfonylmethylsulfonyl)morpholin-2-yl]methanamine |
| SMILES | CC1COC(CN)CN1S(=O)(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C8H18N2O5S2/c1-7-5-15-8(3-9)4-10(7)17(13,14)6-16(2,11)12/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | CWURORARDFGCSU-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |