C7H14BrNO3S — CID 83084634
4-(bromomethylsulfonyl)-2,5-dimethylmorpholine (PubChem CID 83084634) has the molecular formula C7H14BrNO3S and a molecular weight of 272.16 g/mol. Its IUPAC name is 4-(bromomethylsulfonyl)-2,5-dimethylmorpholine.
| Compound Name | 4-(bromomethylsulfonyl)-2,5-dimethylmorpholine |
|---|---|
| PubChem CID | 83084634 |
| Molecular Formula | C7H14BrNO3S |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 4-(bromomethylsulfonyl)-2,5-dimethylmorpholine |
| SMILES | CC1CN(S(=O)(=O)CBr)C(C)CO1 |
| InChI | InChI=1S/C7H14BrNO3S/c1-6-4-12-7(2)3-9(6)13(10,11)5-8/h6-7H,3-5H2,1-2H3 |
| InChIKey | ZDTONGRTVUWQLX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|