About 4-(bromomethylsulfonyl)-2,5-dimethylmorpholine
4-(bromomethylsulfonyl)-2,5-dimethylmorpholine (PubChem CID 83084634) has the molecular formula C7H14BrNO3S
and a molecular weight of 272.16 g/mol. Its IUPAC name is 4-(bromomethylsulfonyl)-2,5-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-(bromomethylsulfonyl)-2,5-dimethylmorpholine |
| PubChem CID | 83084634 |
| Molecular Formula | C7H14BrNO3S |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 4-(bromomethylsulfonyl)-2,5-dimethylmorpholine |
| SMILES | CC1CN(S(=O)(=O)CBr)C(C)CO1 |
| InChI | InChI=1S/C7H14BrNO3S/c1-6-4-12-7(2)3-9(6)13(10,11)5-8/h6-7H,3-5H2,1-2H3 |
| InChIKey | ZDTONGRTVUWQLX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethylsulfonyl)-2,5-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethylsulfonyl)-2,5-dimethylmorpholine?
The IUPAC name of 4-(bromomethylsulfonyl)-2,5-dimethylmorpholine (CID 83084634) is 4-(bromomethylsulfonyl)-2,5-dimethylmorpholine.
What is the SMILES notation for 4-(bromomethylsulfonyl)-2,5-dimethylmorpholine?
The canonical SMILES for 4-(bromomethylsulfonyl)-2,5-dimethylmorpholine is CC1CN(S(=O)(=O)CBr)C(C)CO1.
What is the InChIKey of 4-(bromomethylsulfonyl)-2,5-dimethylmorpholine?
The InChIKey is ZDTONGRTVUWQLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14BrNO3S/c1-6-4-12-7(2)3-9(6)13(10,11)5-8/h6-7H,3-5H2,1-2H3.
What are the key properties of 4-(bromomethylsulfonyl)-2,5-dimethylmorpholine?
4-(bromomethylsulfonyl)-2,5-dimethylmorpholine has a molecular weight of 272.16 g/mol, XLogP of 0.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethylsulfonyl)-2,5-dimethylmorpholine is sourced from PubChem (CID 83084634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).