C8H15NO5S — CID 43544554
2-(2,5-dimethylmorpholin-4-yl)sulfonylacetic acid (PubChem CID 43544554) has the molecular formula C8H15NO5S and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-(2,5-dimethylmorpholin-4-yl)sulfonylacetic acid.
| Compound Name | 2-(2,5-dimethylmorpholin-4-yl)sulfonylacetic acid |
|---|---|
| PubChem CID | 43544554 |
| Molecular Formula | C8H15NO5S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 2-(2,5-dimethylmorpholin-4-yl)sulfonylacetic acid |
| SMILES | CC1CN(S(=O)(=O)CC(=O)O)C(C)CO1 |
| InChI | InChI=1S/C8H15NO5S/c1-6-4-14-7(2)3-9(6)15(12,13)5-8(10)11/h6-7H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | JWXSCCGJZDGJPZ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |