C6H12ClNO3S — CID 94843085
(2S,5R)-2,5-dimethylmorpholine-4-sulfonyl chloride (PubChem CID 94843085) has the molecular formula C6H12ClNO3S and a molecular weight of 213.69 g/mol. Its IUPAC name is (2S,5R)-2,5-dimethylmorpholine-4-sulfonyl chloride.
| Compound Name | (2S,5R)-2,5-dimethylmorpholine-4-sulfonyl chloride |
|---|---|
| PubChem CID | 94843085 |
| Molecular Formula | C6H12ClNO3S |
| Molecular Weight | 213.69 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | (2S,5R)-2,5-dimethylmorpholine-4-sulfonyl chloride |
| SMILES | C[C@@H]1CO[C@@H](C)CN1S(=O)(=O)Cl |
| InChI | InChI=1S/C6H12ClNO3S/c1-5-4-11-6(2)3-8(5)12(7,9)10/h5-6H,3-4H2,1-2H3/t5-,6+/m1/s1 |
| InChIKey | FGFHSVAFDFWLMD-RITPCOANSA-N |
| XLogP | 0.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.69 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |