C10H21NO3S — CID 100567938
(2S,5S)-2,5-dimethyl-4-(2-methylpropylsulfonyl)morpholine (PubChem CID 100567938) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is (2S,5S)-2,5-dimethyl-4-(2-methylpropylsulfonyl)morpholine.
| Compound Name | (2S,5S)-2,5-dimethyl-4-(2-methylpropylsulfonyl)morpholine |
|---|---|
| PubChem CID | 100567938 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (2S,5S)-2,5-dimethyl-4-(2-methylpropylsulfonyl)morpholine |
| SMILES | CC(C)CS(=O)(=O)N1C[C@H](C)OC[C@@H]1C |
| InChI | InChI=1S/C10H21NO3S/c1-8(2)7-15(12,13)11-5-10(4)14-6-9(11)3/h8-10H,5-7H2,1-4H3/t9-,10-/m0/s1 |
| InChIKey | LZTDPACEXHQUCN-UWVGGRQHSA-N |
| XLogP | 1.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |