C10H20N2O4S — CID 98798030
(2R,5S)-2,5-dimethyl-4-morpholin-4-ylsulfonylmorpholine (PubChem CID 98798030) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is (2R,5S)-2,5-dimethyl-4-morpholin-4-ylsulfonylmorpholine.
| Compound Name | (2R,5S)-2,5-dimethyl-4-morpholin-4-ylsulfonylmorpholine |
|---|---|
| PubChem CID | 98798030 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (2R,5S)-2,5-dimethyl-4-morpholin-4-ylsulfonylmorpholine |
| SMILES | C[C@@H]1CN(S(=O)(=O)N2CCOCC2)[C@@H](C)CO1 |
| InChI | InChI=1S/C10H20N2O4S/c1-9-8-16-10(2)7-12(9)17(13,14)11-3-5-15-6-4-11/h9-10H,3-8H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | UDNZYOZZKAVGEU-VHSXEESVSA-N |
| XLogP | -0.33 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |