C9H8F2O3S — CID 81217752
2,2-difluoro-2-(3-methoxyphenyl)sulfanylacetic acid (PubChem CID 81217752) has the molecular formula C9H8F2O3S and a molecular weight of 234.22 g/mol. Its IUPAC name is 2,2-difluoro-2-(3-methoxyphenyl)sulfanylacetic acid.
| Compound Name | 2,2-difluoro-2-(3-methoxyphenyl)sulfanylacetic acid |
|---|---|
| PubChem CID | 81217752 |
| Molecular Formula | C9H8F2O3S |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 2,2-difluoro-2-(3-methoxyphenyl)sulfanylacetic acid |
| SMILES | COc1cccc(SC(F)(F)C(=O)O)c1 |
| InChI | InChI=1S/C9H8F2O3S/c1-14-6-3-2-4-7(5-6)15-9(10,11)8(12)13/h2-5H,1H3,(H,12,13) |
| InChIKey | BFIMUDSZHKRZKE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |