C19H30N2 — CID 81218537
2-methyl-6-(4-propylazepan-1-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 81218537) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 2-methyl-6-(4-propylazepan-1-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 2-methyl-6-(4-propylazepan-1-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 81218537 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 2-methyl-6-(4-propylazepan-1-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | CCCC1CCCN(c2ccc3c(c2)CCC(C)N3)CC1 |
| InChI | InChI=1S/C19H30N2/c1-3-5-16-6-4-12-21(13-11-16)18-9-10-19-17(14-18)8-7-15(2)20-19/h9-10,14-16,20H,3-8,11-13H2,1-2H3 |
| InChIKey | JKLPMGPFGIQHDV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|