C18H28N2 — CID 103496417
2-methyl-6-(4-propan-2-ylpiperidin-1-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 103496417) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 2-methyl-6-(4-propan-2-ylpiperidin-1-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 2-methyl-6-(4-propan-2-ylpiperidin-1-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 103496417 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 2-methyl-6-(4-propan-2-ylpiperidin-1-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1CCc2cc(N3CCC(C(C)C)CC3)ccc2N1 |
| InChI | InChI=1S/C18H28N2/c1-13(2)15-8-10-20(11-9-15)17-6-7-18-16(12-17)5-4-14(3)19-18/h6-7,12-15,19H,4-5,8-11H2,1-3H3 |
| InChIKey | URIGHBDHGDUVJY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|